C29H15BF2N2O2 — CID 145373605
3-fluoro-5-[5-(5-fluoro-3-pyridinyl)-8,14-dioxa-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl]pyridine (PubChem CID 145373605) has the molecular formula C29H15BF2N2O2 and a molecular weight of 472.26 g/mol. Its IUPAC name is 3-fluoro-5-[5-(5-fluoro-3-pyridinyl)-8,14-dioxa-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl]pyridine.
| Compound Name | 3-fluoro-5-[5-(5-fluoro-3-pyridinyl)-8,14-dioxa-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl]pyridine |
|---|---|
| PubChem CID | 145373605 |
| Molecular Formula | C29H15BF2N2O2 |
| Molecular Weight | 472.26 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 3-fluoro-5-[5-(5-fluoro-3-pyridinyl)-8,14-dioxa-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl]pyridine |
| SMILES | Fc1cncc(-c2cc3c4c(c2)Oc2cc(-c5cncc(F)c5)cc5c2B4c2c(cccc2O5)C3)c1 |
| InChI | InChI=1S/C29H15BF2N2O2/c31-21-6-19(11-33-13-21)16-5-18-4-15-2-1-3-23-27(15)30-28(18)24(8-16)36-26-10-17(9-25(35-23)29(26)30)20-7-22(32)14-34-12-20/h1-3,5-14H,4H2 |
| InChIKey | VGSSYKJOUXRLQC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.26 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|