About bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane
bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane (PubChem CID 145373818) has the molecular formula C34H40N2
and a molecular weight of 476.71 g/mol. Its IUPAC name is bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane.
Molecular Properties
| Compound Name | bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane |
| PubChem CID | 145373818 |
| Molecular Formula | C34H40N2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane |
| SMILES | CC.Cc1ccc(CCc2ccc(/N=N/c3ccc(CCc4ccc(C)cc4)cc3C)c(C)c2)cc1 |
| InChI | InChI=1S/C32H34N2.C2H6/c1-23-5-9-27(10-6-23)13-15-29-17-19-31(25(3)21-29)33-34-32-20-18-30(22-26(32)4)16-14-28-11-7-24(2)8-12-28;1-2/h5-12,17-22H,13-16H2,1-4H3;1-2H3/b34-33+; |
| InChIKey | XOAHBEMULHGFMA-GGTLNOMSSA-N |
| XLogP | 9.93 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane?
The IUPAC name of bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane (CID 145373818) is bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane.
What is the SMILES notation for bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane?
The canonical SMILES for bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane is CC.Cc1ccc(CCc2ccc(/N=N/c3ccc(CCc4ccc(C)cc4)cc3C)c(C)c2)cc1.
What is the InChIKey of bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane?
The InChIKey is XOAHBEMULHGFMA-GGTLNOMSSA-N. The full InChI is InChI=1S/C32H34N2.C2H6/c1-23-5-9-27(10-6-23)13-15-29-17-19-31(25(3)21-29)33-34-32-20-18-30(22-26(32)4)16-14-28-11-7-24(2)8-12-28;1-2/h5-12,17-22H,13-16H2,1-4H3;1-2H3/b34-33+;.
What are the key properties of bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane?
bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane has a molecular weight of 476.71 g/mol, XLogP of 9.93, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-methyl-4-[2-(4-methylphenyl)ethyl]phenyl]diazene;ethane is sourced from PubChem (CID 145373818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).