C14H20N2O2S — CID 145374107
4-(4-tert-butylphenyl)sulfonyl-5-methyl-1H-imidazole;molecular hydrogen (PubChem CID 145374107) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)sulfonyl-5-methyl-1H-imidazole;molecular hydrogen.
| Compound Name | 4-(4-tert-butylphenyl)sulfonyl-5-methyl-1H-imidazole;molecular hydrogen |
|---|---|
| PubChem CID | 145374107 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-(4-tert-butylphenyl)sulfonyl-5-methyl-1H-imidazole;molecular hydrogen |
| SMILES | Cc1[nH]cnc1S(=O)(=O)c1ccc(C(C)(C)C)cc1.[H][H] |
| InChI | InChI=1S/C14H18N2O2S.H2/c1-10-13(16-9-15-10)19(17,18)12-7-5-11(6-8-12)14(2,3)4;/h5-9H,1-4H3,(H,15,16);1H |
| InChIKey | HPHPOLNUJKFIHD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |