C22H31NO3S2 — CID 145374132
methyl (Z)-hept-5-enoate;(5E)-5-[5-(2-methylsulfanyl-1,3-thiazol-5-yl)pentylidene]cyclopent-2-en-1-one (PubChem CID 145374132) has the molecular formula C22H31NO3S2 and a molecular weight of 421.63 g/mol. Its IUPAC name is methyl (Z)-hept-5-enoate;(5E)-5-[5-(2-methylsulfanyl-1,3-thiazol-5-yl)pentylidene]cyclopent-2-en-1-one.
| Compound Name | methyl (Z)-hept-5-enoate;(5E)-5-[5-(2-methylsulfanyl-1,3-thiazol-5-yl)pentylidene]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 145374132 |
| Molecular Formula | C22H31NO3S2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | methyl (Z)-hept-5-enoate;(5E)-5-[5-(2-methylsulfanyl-1,3-thiazol-5-yl)pentylidene]cyclopent-2-en-1-one |
| SMILES | C/C=C\CCCC(=O)OC.CSc1ncc(CCCC/C=C2\CC=CC2=O)s1 |
| InChI | InChI=1S/C14H17NOS2.C8H14O2/c1-17-14-15-10-12(18-14)8-4-2-3-6-11-7-5-9-13(11)16;1-3-4-5-6-7-8(9)10-2/h5-6,9-10H,2-4,7-8H2,1H3;3-4H,5-7H2,1-2H3/b11-6+;4-3- |
| InChIKey | JSYHROYRACSLEW-LYLVKYHESA-N |
| XLogP | 5.94 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|