About (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate
(5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate (PubChem CID 145374158) has the molecular formula C21H33FO3
and a molecular weight of 352.49 g/mol. Its IUPAC name is (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate.
Molecular Properties
| Compound Name | (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate |
| PubChem CID | 145374158 |
| Molecular Formula | C21H33FO3 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OC.CCCCCCC/C=C1\CC=C(F)C1=O |
| InChI | InChI=1S/C13H19FO.C8H14O2/c1-2-3-4-5-6-7-8-11-9-10-12(14)13(11)15;1-3-4-5-6-7-8(9)10-2/h8,10H,2-7,9H2,1H3;3-4H,5-7H2,1-2H3/b11-8+;4-3- |
| InChIKey | QLAKNEZJAWLWMZ-KXCLLICCSA-N |
| XLogP | 6.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate?
The IUPAC name of (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate (CID 145374158) is (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate.
What is the SMILES notation for (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate?
The canonical SMILES for (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate is C/C=C\CCCC(=O)OC.CCCCCCC/C=C1\CC=C(F)C1=O.
What is the InChIKey of (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate?
The InChIKey is QLAKNEZJAWLWMZ-KXCLLICCSA-N. The full InChI is InChI=1S/C13H19FO.C8H14O2/c1-2-3-4-5-6-7-8-11-9-10-12(14)13(11)15;1-3-4-5-6-7-8(9)10-2/h8,10H,2-7,9H2,1H3;3-4H,5-7H2,1-2H3/b11-8+;4-3-.
What are the key properties of (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate?
(5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate has a molecular weight of 352.49 g/mol, XLogP of 6.01, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2-fluoro-5-octylidenecyclopent-2-en-1-one;methyl (Z)-hept-5-enoate is sourced from PubChem (CID 145374158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).