C24H50N4O4 — CID 145374873
N,N'-bis(2-aminoethyl)-2,3-dioctoxybutanediamide (PubChem CID 145374873) has the molecular formula C24H50N4O4 and a molecular weight of 458.69 g/mol. Its IUPAC name is N,N'-bis(2-aminoethyl)-2,3-dioctoxybutanediamide.
| Compound Name | N,N'-bis(2-aminoethyl)-2,3-dioctoxybutanediamide |
|---|---|
| PubChem CID | 145374873 |
| Molecular Formula | C24H50N4O4 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | N,N'-bis(2-aminoethyl)-2,3-dioctoxybutanediamide |
| SMILES | CCCCCCCCOC(C(=O)NCCN)C(OCCCCCCCC)C(=O)NCCN |
| InChI | InChI=1S/C24H50N4O4/c1-3-5-7-9-11-13-19-31-21(23(29)27-17-15-25)22(24(30)28-18-16-26)32-20-14-12-10-8-6-4-2/h21-22H,3-20,25-26H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | JSEGMHISYIYBCB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|