C16H31NO — CID 145375824
6-[(Z,5Z)-5-ethylideneoct-6-enoxy]hexan-1-amine (PubChem CID 145375824) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 6-[(Z,5Z)-5-ethylideneoct-6-enoxy]hexan-1-amine.
| Compound Name | 6-[(Z,5Z)-5-ethylideneoct-6-enoxy]hexan-1-amine |
|---|---|
| PubChem CID | 145375824 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 6-[(Z,5Z)-5-ethylideneoct-6-enoxy]hexan-1-amine |
| SMILES | C/C=C\C(=C/C)CCCCOCCCCCCN |
| InChI | InChI=1S/C16H31NO/c1-3-11-16(4-2)12-7-10-15-18-14-9-6-5-8-13-17/h3-4,11H,5-10,12-15,17H2,1-2H3/b11-3-,16-4+ |
| InChIKey | BMADTNSEEBFGNM-GHEYHJKZSA-N |
| XLogP | 4.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|