About 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole
2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole (PubChem CID 145376136) has the molecular formula C24H26N2O2
and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole |
| PubChem CID | 145376136 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole |
| SMILES | COc1cccc(OC)c1C1(Cc2ccccc2)N(C)c2ccccc2N1C |
| InChI | InChI=1S/C24H26N2O2/c1-25-19-13-8-9-14-20(19)26(2)24(25,17-18-11-6-5-7-12-18)23-21(27-3)15-10-16-22(23)28-4/h5-16H,17H2,1-4H3 |
| InChIKey | WWYQYTSLCHIXAY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole?
The IUPAC name of 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole (CID 145376136) is 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole.
What is the SMILES notation for 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole?
The canonical SMILES for 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole is COc1cccc(OC)c1C1(Cc2ccccc2)N(C)c2ccccc2N1C.
What is the InChIKey of 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole?
The InChIKey is WWYQYTSLCHIXAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O2/c1-25-19-13-8-9-14-20(19)26(2)24(25,17-18-11-6-5-7-12-18)23-21(27-3)15-10-16-22(23)28-4/h5-16H,17H2,1-4H3.
What are the key properties of 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole?
2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole has a molecular weight of 374.48 g/mol, XLogP of 4.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-2-(2,6-dimethoxyphenyl)-1,3-dimethylbenzimidazole is sourced from PubChem (CID 145376136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).