C31H29N3O2S — CID 53242679
N-benzyl-3,19-dimethoxy-8,14-dimethyl-8,14-diazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene-1-carbothioamide (PubChem CID 53242679) has the molecular formula C31H29N3O2S and a molecular weight of 507.66 g/mol. Its IUPAC name is N-benzyl-3,19-dimethoxy-8,14-dimethyl-8,14-diazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene-1-carbothioamide.
| Compound Name | N-benzyl-3,19-dimethoxy-8,14-dimethyl-8,14-diazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene-1-carbothioamide |
|---|---|
| PubChem CID | 53242679 |
| Molecular Formula | C31H29N3O2S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | N-benzyl-3,19-dimethoxy-8,14-dimethyl-8,14-diazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene-1-carbothioamide |
| SMILES | COc1cccc2c1C1(C(=S)NCc3ccccc3)c3c(OC)cccc3N(C)c3cccc(c31)N2C |
| InChI | InChI=1S/C31H29N3O2S/c1-33-21-13-8-14-22-27(21)31(28-23(33)15-9-17-25(28)35-3,30(37)32-19-20-11-6-5-7-12-20)29-24(34(22)2)16-10-18-26(29)36-4/h5-18H,19H2,1-4H3,(H,32,37) |
| InChIKey | KKVHUGPRMZNMDZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|