About (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol
(3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol (PubChem CID 145376222) has the molecular formula C19H33NO2
and a molecular weight of 307.48 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol.
Molecular Properties
| Compound Name | (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol |
| PubChem CID | 145376222 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol |
| SMILES | C=CCOc1c(C(C)(C)C)cc(CN)cc1C(C)(C)C.CO |
| InChI | InChI=1S/C18H29NO.CH4O/c1-8-9-20-16-14(17(2,3)4)10-13(12-19)11-15(16)18(5,6)7;1-2/h8,10-11H,1,9,12,19H2,2-7H3;2H,1H3 |
| InChIKey | YKPSUPVYPIQPKR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol?
The IUPAC name of (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol (CID 145376222) is (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol.
What is the SMILES notation for (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol?
The canonical SMILES for (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol is C=CCOc1c(C(C)(C)C)cc(CN)cc1C(C)(C)C.CO.
What is the InChIKey of (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol?
The InChIKey is YKPSUPVYPIQPKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO.CH4O/c1-8-9-20-16-14(17(2,3)4)10-13(12-19)11-15(16)18(5,6)7;1-2/h8,10-11H,1,9,12,19H2,2-7H3;2H,1H3.
What are the key properties of (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol?
(3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol has a molecular weight of 307.48 g/mol, XLogP of 3.91, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol is sourced from PubChem (CID 145376222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).