C19H33NO2 — CID 145376222
(3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol (PubChem CID 145376222) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol.
| Compound Name | (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol |
|---|---|
| PubChem CID | 145376222 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | (3,5-ditert-butyl-4-prop-2-enoxyphenyl)methanamine;methanol |
| SMILES | C=CCOc1c(C(C)(C)C)cc(CN)cc1C(C)(C)C.CO |
| InChI | InChI=1S/C18H29NO.CH4O/c1-8-9-20-16-14(17(2,3)4)10-13(12-19)11-15(16)18(5,6)7;1-2/h8,10-11H,1,9,12,19H2,2-7H3;2H,1H3 |
| InChIKey | YKPSUPVYPIQPKR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|