C24H29ClN4O2S — CID 145378078
tert-butyl formate;7-(4-chlorophenyl)-9-ethyl-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 145378078) has the molecular formula C24H29ClN4O2S and a molecular weight of 473.04 g/mol. Its IUPAC name is tert-butyl formate;7-(4-chlorophenyl)-9-ethyl-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | tert-butyl formate;7-(4-chlorophenyl)-9-ethyl-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 145378078 |
| Molecular Formula | C24H29ClN4O2S |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | tert-butyl formate;7-(4-chlorophenyl)-9-ethyl-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | CC(C)(C)OC=O.CCC1N=C(c2ccc(Cl)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C19H19ClN4S.C5H10O2/c1-5-15-18-23-22-12(4)24(18)19-16(10(2)11(3)25-19)17(21-15)13-6-8-14(20)9-7-13;1-5(2,3)7-4-6/h6-9,15H,5H2,1-4H3;4H,1-3H3 |
| InChIKey | SKVBEHJGUMPUQQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|