C11H22N2 — CID 145378916
ethane;N-ethyl-N-methyl-1-[(Z)-2-methylprop-2-enylideneamino]ethenamine (PubChem CID 145378916) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;N-ethyl-N-methyl-1-[(Z)-2-methylprop-2-enylideneamino]ethenamine.
| Compound Name | ethane;N-ethyl-N-methyl-1-[(Z)-2-methylprop-2-enylideneamino]ethenamine |
|---|---|
| PubChem CID | 145378916 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | ethane;N-ethyl-N-methyl-1-[(Z)-2-methylprop-2-enylideneamino]ethenamine |
| SMILES | C=C(C)/C=N\C(=C)N(C)CC.CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-6-11(5)9(4)10-7-8(2)3;1-2/h7H,2,4,6H2,1,3,5H3;1-2H3/b10-7-; |
| InChIKey | BNNGABFQVBEWFR-VEZAGKLZSA-N |
| XLogP | 3.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|