C11H20FN3 — CID 172631824
(1E)-N-[1-[2-(dimethylamino)ethyl-methylamino]ethenyl]-2-methylprop-2-enimidoyl fluoride (PubChem CID 172631824) has the molecular formula C11H20FN3 and a molecular weight of 213.30 g/mol. Its IUPAC name is (1E)-N-[1-[2-(dimethylamino)ethyl-methylamino]ethenyl]-2-methylprop-2-enimidoyl fluoride.
| Compound Name | (1E)-N-[1-[2-(dimethylamino)ethyl-methylamino]ethenyl]-2-methylprop-2-enimidoyl fluoride |
|---|---|
| PubChem CID | 172631824 |
| Molecular Formula | C11H20FN3 |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | (1E)-N-[1-[2-(dimethylamino)ethyl-methylamino]ethenyl]-2-methylprop-2-enimidoyl fluoride |
| SMILES | C=C(C)/C(F)=N\C(=C)N(C)CCN(C)C |
| InChI | InChI=1S/C11H20FN3/c1-9(2)11(12)13-10(3)15(6)8-7-14(4)5/h1,3,7-8H2,2,4-6H3/b13-11+ |
| InChIKey | BXXXIYOXWLHCJF-ACCUITESSA-N |
| XLogP | 1.90 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|