About N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine
N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine (PubChem CID 145379854) has the molecular formula C18H23ClN4O
and a molecular weight of 346.86 g/mol. Its IUPAC name is N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine.
Molecular Properties
| Compound Name | N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine |
| PubChem CID | 145379854 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine |
| SMILES | CN.[H]/N=C(\c1ccc(Cl)cc1)c1cc(OC)ccc1N(C)/C(C)=N/[H] |
| InChI | InChI=1S/C17H18ClN3O.CH5N/c1-11(19)21(2)16-9-8-14(22-3)10-15(16)17(20)12-4-6-13(18)7-5-12;1-2/h4-10,19-20H,1-3H3;2H2,1H3/b19-11+,20-17+; |
| InChIKey | UDMBLPAXNAKOIB-QBPNXZMQSA-N |
| XLogP | 3.77 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine?
The IUPAC name of N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine (CID 145379854) is N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine.
What is the SMILES notation for N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine?
The canonical SMILES for N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine is CN.[H]/N=C(\c1ccc(Cl)cc1)c1cc(OC)ccc1N(C)/C(C)=N/[H].
What is the InChIKey of N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine?
The InChIKey is UDMBLPAXNAKOIB-QBPNXZMQSA-N. The full InChI is InChI=1S/C17H18ClN3O.CH5N/c1-11(19)21(2)16-9-8-14(22-3)10-15(16)17(20)12-4-6-13(18)7-5-12;1-2/h4-10,19-20H,1-3H3;2H2,1H3/b19-11+,20-17+;.
What are the key properties of N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine?
N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine has a molecular weight of 346.86 g/mol, XLogP of 3.77, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-chlorobenzenecarboximidoyl)-4-methoxyphenyl]-N-methylethanimidamide;methanamine is sourced from PubChem (CID 145379854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).