C15H15ClN2 — CID 142255330
2-(benzenecarboximidoyl)-4-chloro-N,N-dimethylaniline (PubChem CID 142255330) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 2-(benzenecarboximidoyl)-4-chloro-N,N-dimethylaniline.
| Compound Name | 2-(benzenecarboximidoyl)-4-chloro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 142255330 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-(benzenecarboximidoyl)-4-chloro-N,N-dimethylaniline |
| SMILES | [H]/N=C(\c1ccccc1)c1cc(Cl)ccc1N(C)C |
| InChI | InChI=1S/C15H15ClN2/c1-18(2)14-9-8-12(16)10-13(14)15(17)11-6-4-3-5-7-11/h3-10,17H,1-2H3/b17-15+ |
| InChIKey | FTAQLMSTMHKTGK-BMRADRMJSA-N |
| XLogP | 3.82 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|