C28H30ClN3O2S — CID 169181197
N-[2-(benzenecarboximidoyl)-4-chlorophenyl]-3-ethyl-N-[2-oxo-2-(phenylsulfanylamino)ethyl]pentanamide (PubChem CID 169181197) has the molecular formula C28H30ClN3O2S and a molecular weight of 508.09 g/mol. Its IUPAC name is N-[2-(benzenecarboximidoyl)-4-chlorophenyl]-3-ethyl-N-[2-oxo-2-(phenylsulfanylamino)ethyl]pentanamide.
| Compound Name | N-[2-(benzenecarboximidoyl)-4-chlorophenyl]-3-ethyl-N-[2-oxo-2-(phenylsulfanylamino)ethyl]pentanamide |
|---|---|
| PubChem CID | 169181197 |
| Molecular Formula | C28H30ClN3O2S |
| Molecular Weight | 508.09 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | N-[2-(benzenecarboximidoyl)-4-chlorophenyl]-3-ethyl-N-[2-oxo-2-(phenylsulfanylamino)ethyl]pentanamide |
| SMILES | [H]/N=C(\c1ccccc1)c1cc(Cl)ccc1N(CC(=O)NSc1ccccc1)C(=O)CC(CC)CC |
| InChI | InChI=1S/C28H30ClN3O2S/c1-3-20(4-2)17-27(34)32(19-26(33)31-35-23-13-9-6-10-14-23)25-16-15-22(29)18-24(25)28(30)21-11-7-5-8-12-21/h5-16,18,20,30H,3-4,17,19H2,1-2H3,(H,31,33)/b30-28+ |
| InChIKey | HSABMVGAXUNGGV-SJCQXOIGSA-N |
| XLogP | 6.74 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.09 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|