C10H13ClN2 — CID 152746806
5-chloro-N,N,2-trimethylbenzenecarboximidamide (PubChem CID 152746806) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 5-chloro-N,N,2-trimethylbenzenecarboximidamide.
| Compound Name | 5-chloro-N,N,2-trimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 152746806 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 5-chloro-N,N,2-trimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1cc(Cl)ccc1C)N(C)C |
| InChI | InChI=1S/C10H13ClN2/c1-7-4-5-8(11)6-9(7)10(12)13(2)3/h4-6,12H,1-3H3/b12-10- |
| InChIKey | RIYPOLIJJDDRGS-BENRWUELSA-N |
| XLogP | 2.54 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|