C9H6ClI3O — CID 169225432
1-(5-chloro-2-methylphenyl)-2,2,2-triiodoethanone (PubChem CID 169225432) has the molecular formula C9H6ClI3O and a molecular weight of 546.31 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-2,2,2-triiodoethanone.
| Compound Name | 1-(5-chloro-2-methylphenyl)-2,2,2-triiodoethanone |
|---|---|
| PubChem CID | 169225432 |
| Molecular Formula | C9H6ClI3O |
| Molecular Weight | 546.31 g/mol |
| Exact Mass | 545.72 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-2,2,2-triiodoethanone |
| SMILES | Cc1ccc(Cl)cc1C(=O)C(I)(I)I |
| InChI | InChI=1S/C9H6ClI3O/c1-5-2-3-6(10)4-7(5)8(14)9(11,12)13/h2-4H,1H3 |
| InChIKey | CEKZSYJVNHLHSH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|