About 5-chloro-2-methylbenzoyl isocyanate
5-chloro-2-methylbenzoyl isocyanate (PubChem CID 103513052) has the molecular formula C9H6ClNO2
and a molecular weight of 195.60 g/mol. Its IUPAC name is 5-chloro-2-methylbenzoyl isocyanate.
Molecular Properties
| Compound Name | 5-chloro-2-methylbenzoyl isocyanate |
| PubChem CID | 103513052 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.60 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 5-chloro-2-methylbenzoyl isocyanate |
| SMILES | Cc1ccc(Cl)cc1C(=O)N=C=O |
| InChI | InChI=1S/C9H6ClNO2/c1-6-2-3-7(10)4-8(6)9(13)11-5-12/h2-4H,1H3 |
| InChIKey | XXTBQXFQLMXYIC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-methylbenzoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methylbenzoyl isocyanate?
The IUPAC name of 5-chloro-2-methylbenzoyl isocyanate (CID 103513052) is 5-chloro-2-methylbenzoyl isocyanate.
What is the SMILES notation for 5-chloro-2-methylbenzoyl isocyanate?
The canonical SMILES for 5-chloro-2-methylbenzoyl isocyanate is Cc1ccc(Cl)cc1C(=O)N=C=O.
What is the InChIKey of 5-chloro-2-methylbenzoyl isocyanate?
The InChIKey is XXTBQXFQLMXYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2/c1-6-2-3-7(10)4-8(6)9(13)11-5-12/h2-4H,1H3.
What are the key properties of 5-chloro-2-methylbenzoyl isocyanate?
5-chloro-2-methylbenzoyl isocyanate has a molecular weight of 195.60 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methylbenzoyl isocyanate is sourced from PubChem (CID 103513052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).