C23H29FN6O3S — CID 145380236
3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-N-(2-fluoro-4-methylsulfonylphenyl)-2,3-bis(methylimino)propanamide (PubChem CID 145380236) has the molecular formula C23H29FN6O3S and a molecular weight of 488.59 g/mol. Its IUPAC name is 3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-N-(2-fluoro-4-methylsulfonylphenyl)-2,3-bis(methylimino)propanamide.
| Compound Name | 3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-N-(2-fluoro-4-methylsulfonylphenyl)-2,3-bis(methylimino)propanamide |
|---|---|
| PubChem CID | 145380236 |
| Molecular Formula | C23H29FN6O3S |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-N-(2-fluoro-4-methylsulfonylphenyl)-2,3-bis(methylimino)propanamide |
| SMILES | CCc1cnc(N2CCC(C(=N\C)/C(=N/C)C(=O)Nc3ccc(S(C)(=O)=O)cc3F)CC2)nc1 |
| InChI | InChI=1S/C23H29FN6O3S/c1-5-15-13-27-23(28-14-15)30-10-8-16(9-11-30)20(25-2)21(26-3)22(31)29-19-7-6-17(12-18(19)24)34(4,32)33/h6-7,12-14,16H,5,8-11H2,1-4H3,(H,29,31)/b25-20+,26-21- |
| InChIKey | HBAATLXAMAQYNT-IGTPHTRBSA-N |
| XLogP | 2.58 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|