C22H31N3O3S — CID 44608534
5-ethyl-2-[4-[(2R)-4-(4-methylsulfonylphenoxy)butan-2-yl]piperidin-1-yl]pyrimidine (PubChem CID 44608534) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is 5-ethyl-2-[4-[(2R)-4-(4-methylsulfonylphenoxy)butan-2-yl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-ethyl-2-[4-[(2R)-4-(4-methylsulfonylphenoxy)butan-2-yl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 44608534 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 5-ethyl-2-[4-[(2R)-4-(4-methylsulfonylphenoxy)butan-2-yl]piperidin-1-yl]pyrimidine |
| SMILES | CCc1cnc(N2CCC([C@H](C)CCOc3ccc(S(C)(=O)=O)cc3)CC2)nc1 |
| InChI | InChI=1S/C22H31N3O3S/c1-4-18-15-23-22(24-16-18)25-12-9-19(10-13-25)17(2)11-14-28-20-5-7-21(8-6-20)29(3,26)27/h5-8,15-17,19H,4,9-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | LGROXCZKKJITPB-QGZVFWFLSA-N |
| XLogP | 3.76 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |