C25H29N3O3S — CID 44612357
5-ethyl-2-[4-[3-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidin-1-yl]pyrimidine (PubChem CID 44612357) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is 5-ethyl-2-[4-[3-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-ethyl-2-[4-[3-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 44612357 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 5-ethyl-2-[4-[3-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidin-1-yl]pyrimidine |
| SMILES | CCc1cnc(N2CCC(c3cccc(OCc4ccc(S(C)(=O)=O)cc4)c3)CC2)nc1 |
| InChI | InChI=1S/C25H29N3O3S/c1-3-19-16-26-25(27-17-19)28-13-11-21(12-14-28)22-5-4-6-23(15-22)31-18-20-7-9-24(10-8-20)32(2,29)30/h4-10,15-17,21H,3,11-14,18H2,1-2H3 |
| InChIKey | TVZHRPAFNRLMRW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |