C24H35N3O2S — CID 143923526
5-butyl-2-[4-[(2R)-4-(4-methylsulfinylphenoxy)butan-2-yl]piperidin-1-yl]pyrimidine (PubChem CID 143923526) has the molecular formula C24H35N3O2S and a molecular weight of 429.63 g/mol. Its IUPAC name is 5-butyl-2-[4-[(2R)-4-(4-methylsulfinylphenoxy)butan-2-yl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-butyl-2-[4-[(2R)-4-(4-methylsulfinylphenoxy)butan-2-yl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 143923526 |
| Molecular Formula | C24H35N3O2S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 5-butyl-2-[4-[(2R)-4-(4-methylsulfinylphenoxy)butan-2-yl]piperidin-1-yl]pyrimidine |
| SMILES | CCCCc1cnc(N2CCC([C@H](C)CCOc3ccc(S(C)=O)cc3)CC2)nc1 |
| InChI | InChI=1S/C24H35N3O2S/c1-4-5-6-20-17-25-24(26-18-20)27-14-11-21(12-15-27)19(2)13-16-29-22-7-9-23(10-8-22)30(3)28/h7-10,17-19,21H,4-6,11-16H2,1-3H3/t19-,30?/m1/s1 |
| InChIKey | QRMOPHVKNZSYHY-HZRSZRRBSA-N |
| XLogP | 4.88 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |