C22H30ClN3O2S — CID 71165000
5-chloro-2-[4-[3-methyl-5-(4-methylsulfinylphenoxy)pentan-2-yl]piperidin-1-yl]pyrimidine (PubChem CID 71165000) has the molecular formula C22H30ClN3O2S and a molecular weight of 436.02 g/mol. Its IUPAC name is 5-chloro-2-[4-[3-methyl-5-(4-methylsulfinylphenoxy)pentan-2-yl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-chloro-2-[4-[3-methyl-5-(4-methylsulfinylphenoxy)pentan-2-yl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 71165000 |
| Molecular Formula | C22H30ClN3O2S |
| Molecular Weight | 436.02 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 5-chloro-2-[4-[3-methyl-5-(4-methylsulfinylphenoxy)pentan-2-yl]piperidin-1-yl]pyrimidine |
| SMILES | CC(CCOc1ccc(S(C)=O)cc1)C(C)C1CCN(c2ncc(Cl)cn2)CC1 |
| InChI | InChI=1S/C22H30ClN3O2S/c1-16(10-13-28-20-4-6-21(7-5-20)29(3)27)17(2)18-8-11-26(12-9-18)22-24-14-19(23)15-25-22/h4-7,14-18H,8-13H2,1-3H3 |
| InChIKey | MPWXJEQNBUDUPU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.02 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |