C50H40S2 — CID 145380834
2-cyclohex-4-en-2-yn-1-yl-5-[4-[(3R)-3-phenanthren-9-yl-4-[4-(5-phenylthiophen-2-yl)phenyl]butan-2-yl]cyclohexa-1,5-dien-1-yl]thiophene (PubChem CID 145380834) has the molecular formula C50H40S2 and a molecular weight of 705.00 g/mol. Its IUPAC name is 2-cyclohex-4-en-2-yn-1-yl-5-[4-[(3R)-3-phenanthren-9-yl-4-[4-(5-phenylthiophen-2-yl)phenyl]butan-2-yl]cyclohexa-1,5-dien-1-yl]thiophene.
| Compound Name | 2-cyclohex-4-en-2-yn-1-yl-5-[4-[(3R)-3-phenanthren-9-yl-4-[4-(5-phenylthiophen-2-yl)phenyl]butan-2-yl]cyclohexa-1,5-dien-1-yl]thiophene |
|---|---|
| PubChem CID | 145380834 |
| Molecular Formula | C50H40S2 |
| Molecular Weight | 705.00 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | 2-cyclohex-4-en-2-yn-1-yl-5-[4-[(3R)-3-phenanthren-9-yl-4-[4-(5-phenylthiophen-2-yl)phenyl]butan-2-yl]cyclohexa-1,5-dien-1-yl]thiophene |
| SMILES | CC(C1C=CC(c2ccc(C3C#CC=CC3)s2)=CC1)[C@@H](Cc1ccc(-c2ccc(-c3ccccc3)s2)cc1)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C50H40S2/c1-34(36-24-26-40(27-25-36)50-31-29-48(52-50)38-14-6-3-7-15-38)45(46-33-41-16-8-9-17-42(41)43-18-10-11-19-44(43)46)32-35-20-22-39(23-21-35)49-30-28-47(51-49)37-12-4-2-5-13-37/h2-6,8-13,16-24,26-31,33-34,36,38,45H,14,25,32H2,1H3/t34?,36?,38?,45-/m1/s1 |
| InChIKey | UFLMHOJKRBDKJL-VFPRTYBNSA-N |
| XLogP | 14.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.00 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|