C21H16F2N8OS — CID 145383993
2,4-difluoro-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine;1,3-thiazole-5-carbaldehyde (PubChem CID 145383993) has the molecular formula C21H16F2N8OS and a molecular weight of 466.48 g/mol. Its IUPAC name is 2,4-difluoro-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine;1,3-thiazole-5-carbaldehyde.
| Compound Name | 2,4-difluoro-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine;1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 145383993 |
| Molecular Formula | C21H16F2N8OS |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 2,4-difluoro-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine;1,3-thiazole-5-carbaldehyde |
| SMILES | CNc1ccc(F)c(Nc2ncccc2-c2ncnc3nc[nH]c23)c1F.O=Cc1cncs1 |
| InChI | InChI=1S/C17H13F2N7.C4H3NOS/c1-20-11-5-4-10(18)14(12(11)19)26-16-9(3-2-6-21-16)13-15-17(24-7-22-13)25-8-23-15;6-2-4-1-5-3-7-4/h2-8,20H,1H3,(H,21,26)(H,22,23,24,25);1-3H |
| InChIKey | RQMNIJSIKZZCIR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|