C25H22N2 — CID 145384117
(Z)-3-[8-(3-methyl-5-phenylphenyl)quinolin-7-yl]prop-2-en-1-amine (PubChem CID 145384117) has the molecular formula C25H22N2 and a molecular weight of 350.47 g/mol. Its IUPAC name is (Z)-3-[8-(3-methyl-5-phenylphenyl)quinolin-7-yl]prop-2-en-1-amine.
| Compound Name | (Z)-3-[8-(3-methyl-5-phenylphenyl)quinolin-7-yl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 145384117 |
| Molecular Formula | C25H22N2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (Z)-3-[8-(3-methyl-5-phenylphenyl)quinolin-7-yl]prop-2-en-1-amine |
| SMILES | Cc1cc(-c2ccccc2)cc(-c2c(/C=C\CN)ccc3cccnc23)c1 |
| InChI | InChI=1S/C25H22N2/c1-18-15-22(19-7-3-2-4-8-19)17-23(16-18)24-20(9-5-13-26)11-12-21-10-6-14-27-25(21)24/h2-12,14-17H,13,26H2,1H3/b9-5- |
| InChIKey | HSDUZFSRVWOGGK-UITAMQMPSA-N |
| XLogP | 5.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |