C25H26ClN3O8 — CID 145384965
chloromethane;methyl (2R)-4-hydroxy-1-oxo-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-2,3,7,8-tetrahydropyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 145384965) has the molecular formula C25H26ClN3O8 and a molecular weight of 531.95 g/mol. Its IUPAC name is chloromethane;methyl (2R)-4-hydroxy-1-oxo-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-2,3,7,8-tetrahydropyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | chloromethane;methyl (2R)-4-hydroxy-1-oxo-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-2,3,7,8-tetrahydropyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 145384965 |
| Molecular Formula | C25H26ClN3O8 |
| Molecular Weight | 531.95 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | chloromethane;methyl (2R)-4-hydroxy-1-oxo-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-2,3,7,8-tetrahydropyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | CCl.COC(=O)[C@@H]1Nc2c(O)cc3c(c2C1=O)CCN3C(=O)c1cc2cc(OC)c(OC)c(OC)c2[nH]1 |
| InChI | InChI=1S/C24H23N3O8.CH3Cl/c1-32-15-8-10-7-12(25-17(10)22(34-3)21(15)33-2)23(30)27-6-5-11-13(27)9-14(28)18-16(11)20(29)19(26-18)24(31)35-4;1-2/h7-9,19,25-26,28H,5-6H2,1-4H3;1H3/t19-;/m1./s1 |
| InChIKey | ZZMKXPHPKCVRKM-FSRHSHDFSA-N |
| XLogP | 3.11 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.95 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|