C19H21NO2S2 — CID 145385606
(2S)-2-(2-benzyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolan-2-amine (PubChem CID 145385606) has the molecular formula C19H21NO2S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is (2S)-2-(2-benzyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolan-2-amine.
| Compound Name | (2S)-2-(2-benzyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolan-2-amine |
|---|---|
| PubChem CID | 145385606 |
| Molecular Formula | C19H21NO2S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (2S)-2-(2-benzyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolan-2-amine |
| SMILES | N[C@@]1(C2(Cc3ccccc3)OCCO2)SCC(c2ccccc2)S1 |
| InChI | InChI=1S/C19H21NO2S2/c20-19(23-14-17(24-19)16-9-5-2-6-10-16)18(21-11-12-22-18)13-15-7-3-1-4-8-15/h1-10,17H,11-14,20H2/t17?,19-/m0/s1 |
| InChIKey | MHBUNFWCRWPHIB-NNBQYGFHSA-N |
| XLogP | 3.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |