C20H21NO3S2 — CID 145385609
(2S)-2-(2-benzyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolane-2-carboxamide (PubChem CID 145385609) has the molecular formula C20H21NO3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is (2S)-2-(2-benzyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolane-2-carboxamide.
| Compound Name | (2S)-2-(2-benzyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolane-2-carboxamide |
|---|---|
| PubChem CID | 145385609 |
| Molecular Formula | C20H21NO3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (2S)-2-(2-benzyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolane-2-carboxamide |
| SMILES | NC(=O)[C@@]1(C2(Cc3ccccc3)OCCO2)SCC(c2ccccc2)S1 |
| InChI | InChI=1S/C20H21NO3S2/c21-18(22)20(25-14-17(26-20)16-9-5-2-6-10-16)19(23-11-12-24-19)13-15-7-3-1-4-8-15/h1-10,17H,11-14H2,(H2,21,22)/t17?,20-/m1/s1 |
| InChIKey | XTHRPFRLGBTPAB-UUSAFJCLSA-N |
| XLogP | 3.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |