C17H23NO3S2 — CID 145385600
(2R)-2-(2-butyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolane-2-carboxamide (PubChem CID 145385600) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (2R)-2-(2-butyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolane-2-carboxamide.
| Compound Name | (2R)-2-(2-butyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolane-2-carboxamide |
|---|---|
| PubChem CID | 145385600 |
| Molecular Formula | C17H23NO3S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (2R)-2-(2-butyl-1,3-dioxolan-2-yl)-4-phenyl-1,3-dithiolane-2-carboxamide |
| SMILES | CCCCC1([C@@]2(C(N)=O)SCC(c3ccccc3)S2)OCCO1 |
| InChI | InChI=1S/C17H23NO3S2/c1-2-3-9-16(20-10-11-21-16)17(15(18)19)22-12-14(23-17)13-7-5-4-6-8-13/h4-8,14H,2-3,9-12H2,1H3,(H2,18,19)/t14?,17-/m0/s1 |
| InChIKey | ICSWLOARLQACSO-JRZJBTRGSA-N |
| XLogP | 3.32 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |