C17H25NO3S2 — CID 145385637
(2R)-2-[2-(2-methylpropyl)-1,3-dioxolan-2-yl]-2-(1-phenyl-2-sulfanylethyl)sulfanylacetamide (PubChem CID 145385637) has the molecular formula C17H25NO3S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is (2R)-2-[2-(2-methylpropyl)-1,3-dioxolan-2-yl]-2-(1-phenyl-2-sulfanylethyl)sulfanylacetamide.
| Compound Name | (2R)-2-[2-(2-methylpropyl)-1,3-dioxolan-2-yl]-2-(1-phenyl-2-sulfanylethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 145385637 |
| Molecular Formula | C17H25NO3S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (2R)-2-[2-(2-methylpropyl)-1,3-dioxolan-2-yl]-2-(1-phenyl-2-sulfanylethyl)sulfanylacetamide |
| SMILES | CC(C)CC1([C@@H](SC(CS)c2ccccc2)C(N)=O)OCCO1 |
| InChI | InChI=1S/C17H25NO3S2/c1-12(2)10-17(20-8-9-21-17)15(16(18)19)23-14(11-22)13-6-4-3-5-7-13/h3-7,12,14-15,22H,8-11H2,1-2H3,(H2,18,19)/t14?,15-/m0/s1 |
| InChIKey | UDCCPCNMFHBYMS-LOACHALJSA-N |
| XLogP | 3.03 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|