C16H25NO2S2 — CID 145385619
(2S)-3-hydroxy-2,5-dimethyl-2-(2-phenyl-2-sulfanylethyl)sulfanylhexanamide (PubChem CID 145385619) has the molecular formula C16H25NO2S2 and a molecular weight of 327.51 g/mol. Its IUPAC name is (2S)-3-hydroxy-2,5-dimethyl-2-(2-phenyl-2-sulfanylethyl)sulfanylhexanamide.
| Compound Name | (2S)-3-hydroxy-2,5-dimethyl-2-(2-phenyl-2-sulfanylethyl)sulfanylhexanamide |
|---|---|
| PubChem CID | 145385619 |
| Molecular Formula | C16H25NO2S2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2S)-3-hydroxy-2,5-dimethyl-2-(2-phenyl-2-sulfanylethyl)sulfanylhexanamide |
| SMILES | CC(C)CC(O)[C@](C)(SCC(S)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C16H25NO2S2/c1-11(2)9-14(18)16(3,15(17)19)21-10-13(20)12-7-5-4-6-8-12/h4-8,11,13-14,18,20H,9-10H2,1-3H3,(H2,17,19)/t13?,14?,16-/m0/s1 |
| InChIKey | XWRXVSMMMIEOGP-XUJLQICISA-N |
| XLogP | 3.04 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|