C18H19NO2S2 — CID 145385602
(2S)-2-(1-hydroxy-2-phenylethyl)-4-phenyl-1,3-dithiolane-2-carboxamide (PubChem CID 145385602) has the molecular formula C18H19NO2S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (2S)-2-(1-hydroxy-2-phenylethyl)-4-phenyl-1,3-dithiolane-2-carboxamide.
| Compound Name | (2S)-2-(1-hydroxy-2-phenylethyl)-4-phenyl-1,3-dithiolane-2-carboxamide |
|---|---|
| PubChem CID | 145385602 |
| Molecular Formula | C18H19NO2S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (2S)-2-(1-hydroxy-2-phenylethyl)-4-phenyl-1,3-dithiolane-2-carboxamide |
| SMILES | NC(=O)[C@@]1(C(O)Cc2ccccc2)SCC(c2ccccc2)S1 |
| InChI | InChI=1S/C18H19NO2S2/c19-17(21)18(16(20)11-13-7-3-1-4-8-13)22-12-15(23-18)14-9-5-2-6-10-14/h1-10,15-16,20H,11-12H2,(H2,19,21)/t15?,16?,18-/m0/s1 |
| InChIKey | KSIWATQWWNUVND-HTWSVDAQSA-N |
| XLogP | 2.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |