C22H29NO2S2 — CID 169316134
6,8-bis(benzylsulfanyl)-3-deuterio-3-hydroxyoctanamide (PubChem CID 169316134) has the molecular formula C22H29NO2S2 and a molecular weight of 404.62 g/mol. Its IUPAC name is 6,8-bis(benzylsulfanyl)-3-deuterio-3-hydroxyoctanamide.
| Compound Name | 6,8-bis(benzylsulfanyl)-3-deuterio-3-hydroxyoctanamide |
|---|---|
| PubChem CID | 169316134 |
| Molecular Formula | C22H29NO2S2 |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 6,8-bis(benzylsulfanyl)-3-deuterio-3-hydroxyoctanamide |
| SMILES | [2H]C(O)(CCC(CCSCc1ccccc1)SCc1ccccc1)CC(N)=O |
| InChI | InChI=1S/C22H29NO2S2/c23-22(25)15-20(24)11-12-21(27-17-19-9-5-2-6-10-19)13-14-26-16-18-7-3-1-4-8-18/h1-10,20-21,24H,11-17H2,(H2,23,25)/i20D |
| InChIKey | ZJWARBODXDGPFQ-YVHRXSIGSA-N |
| XLogP | 4.63 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|