C22H29NOS2 — CID 56947517
6,8-bis(benzylsulfanyl)octanamide (PubChem CID 56947517) has the molecular formula C22H29NOS2 and a molecular weight of 387.61 g/mol. Its IUPAC name is 6,8-bis(benzylsulfanyl)octanamide.
| Compound Name | 6,8-bis(benzylsulfanyl)octanamide |
|---|---|
| PubChem CID | 56947517 |
| Molecular Formula | C22H29NOS2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 6,8-bis(benzylsulfanyl)octanamide |
| SMILES | NC(=O)CCCCC(CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C22H29NOS2/c23-22(24)14-8-7-13-21(26-18-20-11-5-2-6-12-20)15-16-25-17-19-9-3-1-4-10-19/h1-6,9-12,21H,7-8,13-18H2,(H2,23,24) |
| InChIKey | PQSKLFCPAFTPLQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|