C21H28O3S3 — CID 102593994
5,7-bis(benzylsulfanyl)heptane-1-sulfonic acid (PubChem CID 102593994) has the molecular formula C21H28O3S3 and a molecular weight of 424.65 g/mol. Its IUPAC name is 5,7-bis(benzylsulfanyl)heptane-1-sulfonic acid.
| Compound Name | 5,7-bis(benzylsulfanyl)heptane-1-sulfonic acid |
|---|---|
| PubChem CID | 102593994 |
| Molecular Formula | C21H28O3S3 |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5,7-bis(benzylsulfanyl)heptane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCC(CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C21H28O3S3/c22-27(23,24)16-8-7-13-21(26-18-20-11-5-2-6-12-20)14-15-25-17-19-9-3-1-4-10-19/h1-6,9-12,21H,7-8,13-18H2,(H,22,23,24) |
| InChIKey | YGDOTKMYUYCVPB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|