C25H34OS2 — CID 155032809
(9R)-9,11-bis(benzylsulfanyl)undecan-2-one (PubChem CID 155032809) has the molecular formula C25H34OS2 and a molecular weight of 414.68 g/mol. Its IUPAC name is (9R)-9,11-bis(benzylsulfanyl)undecan-2-one.
| Compound Name | (9R)-9,11-bis(benzylsulfanyl)undecan-2-one |
|---|---|
| PubChem CID | 155032809 |
| Molecular Formula | C25H34OS2 |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (9R)-9,11-bis(benzylsulfanyl)undecan-2-one |
| SMILES | CC(=O)CCCCCC[C@H](CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C25H34OS2/c1-22(26)12-6-2-3-11-17-25(28-21-24-15-9-5-10-16-24)18-19-27-20-23-13-7-4-8-14-23/h4-5,7-10,13-16,25H,2-3,6,11-12,17-21H2,1H3/t25-/m1/s1 |
| InChIKey | ALTXDEGVKQEPFE-RUZDIDTESA-N |
| XLogP | 7.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|