About 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid
6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid (PubChem CID 91262333) has the molecular formula C15H21BO2S2
and a molecular weight of 308.28 g/mol. Its IUPAC name is 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid.
Molecular Properties
| Compound Name | 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid |
| PubChem CID | 91262333 |
| Molecular Formula | C15H21BO2S2 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid |
| SMILES | B#SCCC(CCCCC(=O)O)SCc1ccccc1 |
| InChI | InChI=1S/C15H21BO2S2/c16-20-11-10-14(8-4-5-9-15(17)18)19-12-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,17,18) |
| InChIKey | OMXVUEOMASKRDL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid?
The IUPAC name of 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid (CID 91262333) is 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid.
What is the SMILES notation for 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid?
The canonical SMILES for 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid is B#SCCC(CCCCC(=O)O)SCc1ccccc1.
What is the InChIKey of 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid?
The InChIKey is OMXVUEOMASKRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BO2S2/c16-20-11-10-14(8-4-5-9-15(17)18)19-12-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,17,18).
What are the key properties of 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid?
6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid has a molecular weight of 308.28 g/mol, XLogP of 4.14, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid is sourced from PubChem (CID 91262333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).