6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid

C15H21BO2S2 — CID 91262333

IUPAC6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid
SMILESB#SCCC(CCCCC(=O)O)SCc1ccccc1
InChIInChI=1S/C15H21BO2S2/c16-20-11-10-14(8-4-5-9-15(17)18)19-12-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,17,18)
InChIKeyOMXVUEOMASKRDL-UHFFFAOYSA-N
MW308.28 g/mol
LogP4.14
Rot. Bonds10

About 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid

6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid (PubChem CID 91262333) has the molecular formula C15H21BO2S2 and a molecular weight of 308.28 g/mol. Its IUPAC name is 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid.

Molecular Properties

Compound Name6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid
PubChem CID91262333
Molecular FormulaC15H21BO2S2
Molecular Weight308.28 g/mol
Exact Mass308.11
IUPAC Name6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid
SMILESB#SCCC(CCCCC(=O)O)SCc1ccccc1
InChIInChI=1S/C15H21BO2S2/c16-20-11-10-14(8-4-5-9-15(17)18)19-12-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,17,18)
InChIKeyOMXVUEOMASKRDL-UHFFFAOYSA-N
XLogP4.14
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.28
LogP ≤ 54.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid?
The IUPAC name of 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid (CID 91262333) is 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid.
What is the SMILES notation for 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid?
The canonical SMILES for 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid is B#SCCC(CCCCC(=O)O)SCc1ccccc1.
What is the InChIKey of 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid?
The InChIKey is OMXVUEOMASKRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BO2S2/c16-20-11-10-14(8-4-5-9-15(17)18)19-12-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,17,18).
What are the key properties of 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid?
6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid has a molecular weight of 308.28 g/mol, XLogP of 4.14, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylsulfanyl-8-(boranylidyne-λ4-sulfanyl)octanoic acid is sourced from PubChem (CID 91262333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).