C26H37NOS2 — CID 70881580
6,8-bis(benzylsulfanyl)-N,N-diethyloctanamide (PubChem CID 70881580) has the molecular formula C26H37NOS2 and a molecular weight of 443.72 g/mol. Its IUPAC name is 6,8-bis(benzylsulfanyl)-N,N-diethyloctanamide.
| Compound Name | 6,8-bis(benzylsulfanyl)-N,N-diethyloctanamide |
|---|---|
| PubChem CID | 70881580 |
| Molecular Formula | C26H37NOS2 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 6,8-bis(benzylsulfanyl)-N,N-diethyloctanamide |
| SMILES | CCN(CC)C(=O)CCCCC(CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C26H37NOS2/c1-3-27(4-2)26(28)18-12-11-17-25(30-22-24-15-9-6-10-16-24)19-20-29-21-23-13-7-5-8-14-23/h5-10,13-16,25H,3-4,11-12,17-22H2,1-2H3 |
| InChIKey | VYKSIGUDTDELIY-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|