C24H33NO4S3 — CID 118615180
2-[6,8-bis(benzylsulfanyl)octanoylamino]ethanesulfonic acid (PubChem CID 118615180) has the molecular formula C24H33NO4S3 and a molecular weight of 495.73 g/mol. Its IUPAC name is 2-[6,8-bis(benzylsulfanyl)octanoylamino]ethanesulfonic acid.
| Compound Name | 2-[6,8-bis(benzylsulfanyl)octanoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 118615180 |
| Molecular Formula | C24H33NO4S3 |
| Molecular Weight | 495.73 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-[6,8-bis(benzylsulfanyl)octanoylamino]ethanesulfonic acid |
| SMILES | O=C(CCCCC(CCSCc1ccccc1)SCc1ccccc1)NCCS(=O)(=O)O |
| InChI | InChI=1S/C24H33NO4S3/c26-24(25-16-18-32(27,28)29)14-8-7-13-23(31-20-22-11-5-2-6-12-22)15-17-30-19-21-9-3-1-4-10-21/h1-6,9-12,23H,7-8,13-20H2,(H,25,26)(H,27,28,29) |
| InChIKey | CDSWAONYWYAOKC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|