C18H26NNaO3S2 — CID 25063066
sodium 6-(3-amino-3-oxopropyl)sulfanyl-8-benzylsulfanyloctanoate (PubChem CID 25063066) has the molecular formula C18H26NNaO3S2 and a molecular weight of 391.53 g/mol. Its IUPAC name is sodium 6-(3-amino-3-oxopropyl)sulfanyl-8-benzylsulfanyloctanoate.
| Compound Name | sodium 6-(3-amino-3-oxopropyl)sulfanyl-8-benzylsulfanyloctanoate |
|---|---|
| PubChem CID | 25063066 |
| Molecular Formula | C18H26NNaO3S2 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | sodium 6-(3-amino-3-oxopropyl)sulfanyl-8-benzylsulfanyloctanoate |
| SMILES | NC(=O)CCSC(CCCCC(=O)[O-])CCSCc1ccccc1.[Na+] |
| InChI | InChI=1S/C18H27NO3S2.Na/c19-17(20)11-13-24-16(8-4-5-9-18(21)22)10-12-23-14-15-6-2-1-3-7-15;/h1-3,6-7,16H,4-5,8-14H2,(H2,19,20)(H,21,22);/q;+1/p-1 |
| InChIKey | VGIRXOITQCEIDN-UHFFFAOYSA-M |
| XLogP | -0.40 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|