C22H26B2O2S2 — CID 155578841
CID 155578841 (PubChem CID 155578841) has the molecular formula C22H26B2O2S2 and a molecular weight of 408.21 g/mol.
| Compound Name | CID 155578841 |
|---|---|
| PubChem CID | 155578841 |
| Molecular Formula | C22H26B2O2S2 |
| Molecular Weight | 408.21 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | — |
| SMILES | [B]c1cccc([B])c1CSCCC(CCCCC(=O)O)SCc1ccccc1 |
| InChI | InChI=1S/C22H26B2O2S2/c23-20-10-6-11-21(24)19(20)16-27-14-13-18(9-4-5-12-22(25)26)28-15-17-7-2-1-3-8-17/h1-3,6-8,10-11,18H,4-5,9,12-16H2,(H,25,26) |
| InChIKey | QOGBCIAPHKGZKR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|