C22H28O4S2 — CID 155578732
6-benzylsulfanyl-8-[dihydroxy(phenyl)methyl]sulfanyloctanoic acid (PubChem CID 155578732) has the molecular formula C22H28O4S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 6-benzylsulfanyl-8-[dihydroxy(phenyl)methyl]sulfanyloctanoic acid.
| Compound Name | 6-benzylsulfanyl-8-[dihydroxy(phenyl)methyl]sulfanyloctanoic acid |
|---|---|
| PubChem CID | 155578732 |
| Molecular Formula | C22H28O4S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 6-benzylsulfanyl-8-[dihydroxy(phenyl)methyl]sulfanyloctanoic acid |
| SMILES | O=C(O)CCCCC(CCSC(O)(O)c1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C22H28O4S2/c23-21(24)14-8-7-13-20(27-17-18-9-3-1-4-10-18)15-16-28-22(25,26)19-11-5-2-6-12-19/h1-6,9-12,20,25-26H,7-8,13-17H2,(H,23,24) |
| InChIKey | OCYMCKFTEARWEC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|