C30H46N2OS2 — CID 155032599
6,8-bis(benzylsulfanyl)-N-[2-(dipropylamino)ethyl]octanamide (PubChem CID 155032599) has the molecular formula C30H46N2OS2 and a molecular weight of 514.85 g/mol. Its IUPAC name is 6,8-bis(benzylsulfanyl)-N-[2-(dipropylamino)ethyl]octanamide.
| Compound Name | 6,8-bis(benzylsulfanyl)-N-[2-(dipropylamino)ethyl]octanamide |
|---|---|
| PubChem CID | 155032599 |
| Molecular Formula | C30H46N2OS2 |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 6,8-bis(benzylsulfanyl)-N-[2-(dipropylamino)ethyl]octanamide |
| SMILES | CCCN(CCC)CCNC(=O)CCCCC(CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C30H46N2OS2/c1-3-21-32(22-4-2)23-20-31-30(33)18-12-11-17-29(35-26-28-15-9-6-10-16-28)19-24-34-25-27-13-7-5-8-14-27/h5-10,13-16,29H,3-4,11-12,17-26H2,1-2H3,(H,31,33) |
| InChIKey | AZLKBZINDOMLGB-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|