C24H32INO3S3 — CID 118615049
2-[6,8-bis(benzylsulfanyl)octanoylamino]ethanesulfonyl iodide (PubChem CID 118615049) has the molecular formula C24H32INO3S3 and a molecular weight of 605.63 g/mol. Its IUPAC name is 2-[6,8-bis(benzylsulfanyl)octanoylamino]ethanesulfonyl iodide.
| Compound Name | 2-[6,8-bis(benzylsulfanyl)octanoylamino]ethanesulfonyl iodide |
|---|---|
| PubChem CID | 118615049 |
| Molecular Formula | C24H32INO3S3 |
| Molecular Weight | 605.63 g/mol |
| Exact Mass | 605.06 |
| IUPAC Name | 2-[6,8-bis(benzylsulfanyl)octanoylamino]ethanesulfonyl iodide |
| SMILES | O=C(CCCCC(CCSCc1ccccc1)SCc1ccccc1)NCCS(=O)(=O)I |
| InChI | InChI=1S/C24H32INO3S3/c25-32(28,29)18-16-26-24(27)14-8-7-13-23(31-20-22-11-5-2-6-12-22)15-17-30-19-21-9-3-1-4-10-21/h1-6,9-12,23H,7-8,13-20H2,(H,26,27) |
| InChIKey | BPEVOZIMHVPLBY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|