C22H31NO3S2 — CID 155578788
8-benzylsulfanyl-3,3-dihydroxyoctanamide;phenylmethanethiol (PubChem CID 155578788) has the molecular formula C22H31NO3S2 and a molecular weight of 421.63 g/mol. Its IUPAC name is 8-benzylsulfanyl-3,3-dihydroxyoctanamide;phenylmethanethiol.
| Compound Name | 8-benzylsulfanyl-3,3-dihydroxyoctanamide;phenylmethanethiol |
|---|---|
| PubChem CID | 155578788 |
| Molecular Formula | C22H31NO3S2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 8-benzylsulfanyl-3,3-dihydroxyoctanamide;phenylmethanethiol |
| SMILES | NC(=O)CC(O)(O)CCCCCSCc1ccccc1.SCc1ccccc1 |
| InChI | InChI=1S/C15H23NO3S.C7H8S/c16-14(17)11-15(18,19)9-5-2-6-10-20-12-13-7-3-1-4-8-13;8-6-7-4-2-1-3-5-7/h1,3-4,7-8,18-19H,2,5-6,9-12H2,(H2,16,17);1-5,8H,6H2 |
| InChIKey | GHPGVLZCBLKLSI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|