C15H23NO3S — CID 155578789
8-benzylsulfanyl-3,3-dihydroxyoctanamide (PubChem CID 155578789) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 8-benzylsulfanyl-3,3-dihydroxyoctanamide.
| Compound Name | 8-benzylsulfanyl-3,3-dihydroxyoctanamide |
|---|---|
| PubChem CID | 155578789 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 8-benzylsulfanyl-3,3-dihydroxyoctanamide |
| SMILES | NC(=O)CC(O)(O)CCCCCSCc1ccccc1 |
| InChI | InChI=1S/C15H23NO3S/c16-14(17)11-15(18,19)9-5-2-6-10-20-12-13-7-3-1-4-8-13/h1,3-4,7-8,18-19H,2,5-6,9-12H2,(H2,16,17) |
| InChIKey | JPSOTQPJUXPRKI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|