C20H23FN2O2 — CID 145385826
ethane;4-[(3-ethenyl-4-fluorophenyl)methyl]-2H-phthalazin-1-one;methanol (PubChem CID 145385826) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is ethane;4-[(3-ethenyl-4-fluorophenyl)methyl]-2H-phthalazin-1-one;methanol.
| Compound Name | ethane;4-[(3-ethenyl-4-fluorophenyl)methyl]-2H-phthalazin-1-one;methanol |
|---|---|
| PubChem CID | 145385826 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | ethane;4-[(3-ethenyl-4-fluorophenyl)methyl]-2H-phthalazin-1-one;methanol |
| SMILES | C=Cc1cc(Cc2n[nH]c(=O)c3ccccc23)ccc1F.CC.CO |
| InChI | InChI=1S/C17H13FN2O.C2H6.CH4O/c1-2-12-9-11(7-8-15(12)18)10-16-13-5-3-4-6-14(13)17(21)20-19-16;2*1-2/h2-9H,1,10H2,(H,20,21);1-2H3;2H,1H3 |
| InChIKey | MKAUMMYWHQZGHC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |