C21H21FN2O4 — CID 169219558
5-[(7-cyclobutyloxy-4-oxo-3H-phthalazin-1-yl)methyl]-2-fluorobenzaldehyde;methanol (PubChem CID 169219558) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is 5-[(7-cyclobutyloxy-4-oxo-3H-phthalazin-1-yl)methyl]-2-fluorobenzaldehyde;methanol.
| Compound Name | 5-[(7-cyclobutyloxy-4-oxo-3H-phthalazin-1-yl)methyl]-2-fluorobenzaldehyde;methanol |
|---|---|
| PubChem CID | 169219558 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 5-[(7-cyclobutyloxy-4-oxo-3H-phthalazin-1-yl)methyl]-2-fluorobenzaldehyde;methanol |
| SMILES | CO.O=Cc1cc(Cc2n[nH]c(=O)c3ccc(OC4CCC4)cc23)ccc1F |
| InChI | InChI=1S/C20H17FN2O3.CH4O/c21-18-7-4-12(8-13(18)11-24)9-19-17-10-15(26-14-2-1-3-14)5-6-16(17)20(25)23-22-19;1-2/h4-8,10-11,14H,1-3,9H2,(H,23,25);2H,1H3 |
| InChIKey | LNTFGXJBGVWQOI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|